C17H27NSi2 — CID 11779651
1-naphthalen-1-yl-N,N-bis(trimethylsilyl)methanamine (PubChem CID 11779651) has the molecular formula C17H27NSi2 and a molecular weight of 301.58 g/mol. Its IUPAC name is 1-naphthalen-1-yl-N,N-bis(trimethylsilyl)methanamine.
| Compound Name | 1-naphthalen-1-yl-N,N-bis(trimethylsilyl)methanamine |
|---|---|
| PubChem CID | 11779651 |
| Molecular Formula | C17H27NSi2 |
| Molecular Weight | 301.58 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-naphthalen-1-yl-N,N-bis(trimethylsilyl)methanamine |
| SMILES | C[Si](C)(C)N(Cc1cccc2ccccc12)[Si](C)(C)C |
| InChI | InChI=1S/C17H27NSi2/c1-19(2,3)18(20(4,5)6)14-16-12-9-11-15-10-7-8-13-17(15)16/h7-13H,14H2,1-6H3 |
| InChIKey | LNMUTNWDKWAJDL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|