C16H17NO5 — CID 11779735
(1S,4R,6S)-4,6-dimethoxy-5-oxa-9-azatetracyclo[7.7.0.01,12.02,6]hexadeca-2,11,13-triene-10,15-dione (PubChem CID 11779735) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is (1S,4R,6S)-4,6-dimethoxy-5-oxa-9-azatetracyclo[7.7.0.01,12.02,6]hexadeca-2,11,13-triene-10,15-dione.
| Compound Name | (1S,4R,6S)-4,6-dimethoxy-5-oxa-9-azatetracyclo[7.7.0.01,12.02,6]hexadeca-2,11,13-triene-10,15-dione |
|---|---|
| PubChem CID | 11779735 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (1S,4R,6S)-4,6-dimethoxy-5-oxa-9-azatetracyclo[7.7.0.01,12.02,6]hexadeca-2,11,13-triene-10,15-dione |
| SMILES | CO[C@H]1C=C2[C@](OC)(CCN3C(=O)C=C4C=CC(=O)C[C@]423)O1 |
| InChI | InChI=1S/C16H17NO5/c1-20-14-8-12-15-9-11(18)4-3-10(15)7-13(19)17(15)6-5-16(12,21-2)22-14/h3-4,7-8,14H,5-6,9H2,1-2H3/t14-,15+,16+/m1/s1 |
| InChIKey | WQTOUDSSQLUOGS-PMPSAXMXSA-N |
| XLogP | 0.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|