C18H25ClN2 — CID 11779840
1-chloro-N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine (PubChem CID 11779840) has the molecular formula C18H25ClN2 and a molecular weight of 304.87 g/mol. Its IUPAC name is 1-chloro-N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine.
| Compound Name | 1-chloro-N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine |
|---|---|
| PubChem CID | 11779840 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.87 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-chloro-N,N-dipropyl-6,7,8,9-tetrahydro-3H-benzo[e]indol-8-amine |
| SMILES | CCCN(CCC)C1CCc2ccc3[nH]cc(Cl)c3c2C1 |
| InChI | InChI=1S/C18H25ClN2/c1-3-9-21(10-4-2)14-7-5-13-6-8-17-18(15(13)11-14)16(19)12-20-17/h6,8,12,14,20H,3-5,7,9-11H2,1-2H3 |
| InChIKey | AXWVKOPRBOVXMC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.87 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |