About (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline
(2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline (PubChem CID 11779857) has the molecular formula C18H18F3N
and a molecular weight of 305.34 g/mol. Its IUPAC name is (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline |
| PubChem CID | 11779857 |
| Molecular Formula | C18H18F3N |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline |
| SMILES | CCN1c2ccccc2[C@@H](c2ccccc2)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C18H18F3N/c1-2-22-16-11-7-6-10-14(16)15(12-17(22)18(19,20)21)13-8-4-3-5-9-13/h3-11,15,17H,2,12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | DETQSVMLANDWAH-NVXWUHKLSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline?
The IUPAC name of (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline (CID 11779857) is (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline.
What is the SMILES notation for (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline?
The canonical SMILES for (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline is CCN1c2ccccc2[C@@H](c2ccccc2)C[C@@H]1C(F)(F)F.
What is the InChIKey of (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline?
The InChIKey is DETQSVMLANDWAH-NVXWUHKLSA-N. The full InChI is InChI=1S/C18H18F3N/c1-2-22-16-11-7-6-10-14(16)15(12-17(22)18(19,20)21)13-8-4-3-5-9-13/h3-11,15,17H,2,12H2,1H3/t15-,17-/m1/s1.
What are the key properties of (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline?
(2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline has a molecular weight of 305.34 g/mol, XLogP of 4.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-1-ethyl-4-phenyl-2-(trifluoromethyl)-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 11779857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).