About (2-methoxyphenyl) trifluoromethanesulfonate
(2-methoxyphenyl) trifluoromethanesulfonate (PubChem CID 11780115) has the molecular formula C8H7F3O4S
and a molecular weight of 256.20 g/mol. Its IUPAC name is (2-methoxyphenyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-methoxyphenyl) trifluoromethanesulfonate |
| PubChem CID | 11780115 |
| Molecular Formula | C8H7F3O4S |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | (2-methoxyphenyl) trifluoromethanesulfonate |
| SMILES | COc1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C8H7F3O4S/c1-14-6-4-2-3-5-7(6)15-16(12,13)8(9,10)11/h2-5H,1H3 |
| InChIKey | RCDZTJFBROIDKD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxyphenyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxyphenyl) trifluoromethanesulfonate?
The IUPAC name of (2-methoxyphenyl) trifluoromethanesulfonate (CID 11780115) is (2-methoxyphenyl) trifluoromethanesulfonate.
What is the SMILES notation for (2-methoxyphenyl) trifluoromethanesulfonate?
The canonical SMILES for (2-methoxyphenyl) trifluoromethanesulfonate is COc1ccccc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (2-methoxyphenyl) trifluoromethanesulfonate?
The InChIKey is RCDZTJFBROIDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O4S/c1-14-6-4-2-3-5-7(6)15-16(12,13)8(9,10)11/h2-5H,1H3.
What are the key properties of (2-methoxyphenyl) trifluoromethanesulfonate?
(2-methoxyphenyl) trifluoromethanesulfonate has a molecular weight of 256.20 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxyphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 11780115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).