About methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate
methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 11780297) has the molecular formula C13H11FN2O3
and a molecular weight of 262.24 g/mol. Its IUPAC name is methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 11780297 |
| Molecular Formula | C13H11FN2O3 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)C1COC(c2cc3cc(F)ccc3[nH]2)=N1 |
| InChI | InChI=1S/C13H11FN2O3/c1-18-13(17)11-6-19-12(16-11)10-5-7-4-8(14)2-3-9(7)15-10/h2-5,11,15H,6H2,1H3 |
| InChIKey | ZSPCJOBPVBFRIH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 11780297) is methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate is COC(=O)C1COC(c2cc3cc(F)ccc3[nH]2)=N1.
What is the InChIKey of methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is ZSPCJOBPVBFRIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FN2O3/c1-18-13(17)11-6-19-12(16-11)10-5-7-4-8(14)2-3-9(7)15-10/h2-5,11,15H,6H2,1H3.
What are the key properties of methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 262.24 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 11780297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).