C22H21NO4 — CID 1178038
7-[(2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one (PubChem CID 1178038) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 7-[(2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one.
| Compound Name | 7-[(2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 1178038 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 7-[(2R)-1-(3,4-dihydro-2H-quinolin-1-yl)-1-oxopropan-2-yl]oxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(O[C@H](C)C(=O)N3CCCc4ccccc43)ccc12 |
| InChI | InChI=1S/C22H21NO4/c1-14-12-21(24)27-20-13-17(9-10-18(14)20)26-15(2)22(25)23-11-5-7-16-6-3-4-8-19(16)23/h3-4,6,8-10,12-13,15H,5,7,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | JCKJQQBIFRYXFD-OAHLLOKOSA-N |
| XLogP | 3.85 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|