About (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium
(Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium (PubChem CID 11780485) has the molecular formula C10H8BrN2O2+
and a molecular weight of 268.09 g/mol. Its IUPAC name is (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium.
Molecular Properties
| Compound Name | (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium |
| PubChem CID | 11780485 |
| Molecular Formula | C10H8BrN2O2+ |
| Molecular Weight | 268.09 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium |
| SMILES | N#[N+]/C=C(\O)[C@@H]1O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H7BrN2O2/c11-7-3-1-6(2-4-7)9-10(15-9)8(14)5-13-12/h1-5,9-10H/p+1/b8-5-/t9-,10-/m0/s1 |
| InChIKey | BOTDIISRJCXVTK-VAJAEUGUSA-O |
| XLogP | 3.14 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium?
The IUPAC name of (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium (CID 11780485) is (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium.
What is the SMILES notation for (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium?
The canonical SMILES for (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium is N#[N+]/C=C(\O)[C@@H]1O[C@H]1c1ccc(Br)cc1.
What is the InChIKey of (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium?
The InChIKey is BOTDIISRJCXVTK-VAJAEUGUSA-O. The full InChI is InChI=1S/C10H7BrN2O2/c11-7-3-1-6(2-4-7)9-10(15-9)8(14)5-13-12/h1-5,9-10H/p+1/b8-5-/t9-,10-/m0/s1.
What are the key properties of (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium?
(Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium has a molecular weight of 268.09 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[(2R,3S)-3-(4-bromophenyl)oxiran-2-yl]-2-hydroxyethenediazonium is sourced from PubChem (CID 11780485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).