C16H18O3S — CID 11781263
2-(benzenesulfonyl)-1-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone (PubChem CID 11781263) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone.
| Compound Name | 2-(benzenesulfonyl)-1-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
|---|---|
| PubChem CID | 11781263 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-(benzenesulfonyl)-1-[(1R,2R,3S,4S)-3-methyl-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
| SMILES | C[C@@H]1[C@@H](C(=O)CS(=O)(=O)c2ccccc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H18O3S/c1-11-12-7-8-13(9-12)16(11)15(17)10-20(18,19)14-5-3-2-4-6-14/h2-8,11-13,16H,9-10H2,1H3/t11-,12+,13-,16+/m0/s1 |
| InChIKey | BJQKGTQTMYZXEZ-RSUWNVLCSA-N |
| XLogP | 2.49 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|