C18H29NO2 — CID 11781293
tert-butyl (2R)-3-methyl-2-[[[(1S)-1-phenylethyl]amino]methyl]butanoate (PubChem CID 11781293) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is tert-butyl (2R)-3-methyl-2-[[[(1S)-1-phenylethyl]amino]methyl]butanoate.
| Compound Name | tert-butyl (2R)-3-methyl-2-[[[(1S)-1-phenylethyl]amino]methyl]butanoate |
|---|---|
| PubChem CID | 11781293 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | tert-butyl (2R)-3-methyl-2-[[[(1S)-1-phenylethyl]amino]methyl]butanoate |
| SMILES | CC(C)[C@H](CN[C@@H](C)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO2/c1-13(2)16(17(20)21-18(4,5)6)12-19-14(3)15-10-8-7-9-11-15/h7-11,13-14,16,19H,12H2,1-6H3/t14-,16-/m0/s1 |
| InChIKey | FCYPIZJBKQBFSN-HOCLYGCPSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |