About 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one
2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one (PubChem CID 11781868) has the molecular formula C18H22N4O
and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one |
| PubChem CID | 11781868 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one |
| SMILES | CCN(CC)CCNc1ccc2[nH]c(=O)c3ccccc3c2n1 |
| InChI | InChI=1S/C18H22N4O/c1-3-22(4-2)12-11-19-16-10-9-15-17(21-16)13-7-5-6-8-14(13)18(23)20-15/h5-10H,3-4,11-12H2,1-2H3,(H,19,21)(H,20,23) |
| InChIKey | JHVKDQAXWUMOCB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one?
The IUPAC name of 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one (CID 11781868) is 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one.
What is the SMILES notation for 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one?
The canonical SMILES for 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one is CCN(CC)CCNc1ccc2[nH]c(=O)c3ccccc3c2n1.
What is the InChIKey of 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one?
The InChIKey is JHVKDQAXWUMOCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O/c1-3-22(4-2)12-11-19-16-10-9-15-17(21-16)13-7-5-6-8-14(13)18(23)20-15/h5-10H,3-4,11-12H2,1-2H3,(H,19,21)(H,20,23).
What are the key properties of 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one?
2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one has a molecular weight of 310.40 g/mol, XLogP of 2.83, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethylamino]-5H-benzo[c][1,5]naphthyridin-6-one is sourced from PubChem (CID 11781868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).