About 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride
1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride (PubChem CID 11782137) has the molecular formula C15H18Cl3N
and a molecular weight of 318.68 g/mol. Its IUPAC name is 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride.
Molecular Properties
| Compound Name | 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride |
| PubChem CID | 11782137 |
| Molecular Formula | C15H18Cl3N |
| Molecular Weight | 318.68 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride |
| SMILES | CC1CCC[NH+](CC#Cc2cc(Cl)cc(Cl)c2)C1.[Cl-] |
| InChI | InChI=1S/C15H17Cl2N.ClH/c1-12-4-2-6-18(11-12)7-3-5-13-8-14(16)10-15(17)9-13;/h8-10,12H,2,4,6-7,11H2,1H3;1H |
| InChIKey | GPNCGDOGOJQVFI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.68 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride?
The IUPAC name of 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride (CID 11782137) is 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride.
What is the SMILES notation for 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride?
The canonical SMILES for 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride is CC1CCC[NH+](CC#Cc2cc(Cl)cc(Cl)c2)C1.[Cl-].
What is the InChIKey of 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride?
The InChIKey is GPNCGDOGOJQVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2N.ClH/c1-12-4-2-6-18(11-12)7-3-5-13-8-14(16)10-15(17)9-13;/h8-10,12H,2,4,6-7,11H2,1H3;1H.
What are the key properties of 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride?
1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride has a molecular weight of 318.68 g/mol, XLogP of -0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,5-dichlorophenyl)prop-2-ynyl]-3-methylpiperidin-1-ium chloride is sourced from PubChem (CID 11782137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).