C19H36O2Si — CID 11782315
(1S,4S)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-ol (PubChem CID 11782315) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is (1S,4S)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-ol.
| Compound Name | (1S,4S)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11782315 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (1S,4S)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]cyclopent-2-en-1-ol |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1C=C[C@@H](O)C1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-7-8-9-10-18(21-22(5,6)19(2,3)4)14-12-16-11-13-17(20)15-16/h11-14,16-18,20H,7-10,15H2,1-6H3/b14-12+/t16-,17+,18-/m0/s1 |
| InChIKey | ZGXVDEPFNHLRGU-JYYURTCRSA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|