C20H18N2O3 — CID 11782591
methyl 9-oxo-8,16-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,12,14(19)-hexaene-3-carboxylate (PubChem CID 11782591) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 9-oxo-8,16-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,12,14(19)-hexaene-3-carboxylate.
| Compound Name | methyl 9-oxo-8,16-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,12,14(19)-hexaene-3-carboxylate |
|---|---|
| PubChem CID | 11782591 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 9-oxo-8,16-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,12,14(19)-hexaene-3-carboxylate |
| SMILES | COC(=O)c1cccc2c1c1c3c(cc4c1n2C(=O)CC4)CNCC3 |
| InChI | InChI=1S/C20H18N2O3/c1-25-20(24)14-3-2-4-15-17(14)18-13-7-8-21-10-12(13)9-11-5-6-16(23)22(15)19(11)18/h2-4,9,21H,5-8,10H2,1H3 |
| InChIKey | FDWLWYGRBKLFLR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |