C20H25N5 — CID 11782622
2,6-dibutyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium (PubChem CID 11782622) has the molecular formula C20H25N5 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2,6-dibutyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium.
| Compound Name | 2,6-dibutyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 11782622 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2,6-dibutyl-4-phenyl-1-(1,2,3-triaza-4-azanidacyclopenta-2,5-dien-5-yl)pyridin-1-ium |
| SMILES | CCCCc1cc(-c2ccccc2)cc(CCCC)[n+]1-c1nnn[n-]1 |
| InChI | InChI=1S/C20H25N5/c1-3-5-12-18-14-17(16-10-8-7-9-11-16)15-19(13-6-4-2)25(18)20-21-23-24-22-20/h7-11,14-15H,3-6,12-13H2,1-2H3 |
| InChIKey | MKLYMWWJSQJSLQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|