About 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate
2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate (PubChem CID 11782746) has the molecular formula C17H16F3NO3
and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate.
Molecular Properties
| Compound Name | 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate |
| PubChem CID | 11782746 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NO3/c18-17(19,20)14-7-4-8-15(11-14)23-9-10-24-16(22)21-12-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,21,22) |
| InChIKey | DNQWYAVQAJZNLK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate?
The IUPAC name of 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate (CID 11782746) is 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate.
What is the SMILES notation for 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate?
The canonical SMILES for 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate is O=C(NCc1ccccc1)OCCOc1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate?
The InChIKey is DNQWYAVQAJZNLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F3NO3/c18-17(19,20)14-7-4-8-15(11-14)23-9-10-24-16(22)21-12-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,21,22).
What are the key properties of 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate?
2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate has a molecular weight of 339.31 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(trifluoromethyl)phenoxy]ethyl N-benzylcarbamate is sourced from PubChem (CID 11782746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).