C17H30O5Si — CID 11782842
(3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-4-(methoxymethyl)-6-methyl-7,7a-dihydro-4H-1-benzofuran-3-one (PubChem CID 11782842) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is (3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-4-(methoxymethyl)-6-methyl-7,7a-dihydro-4H-1-benzofuran-3-one.
| Compound Name | (3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-4-(methoxymethyl)-6-methyl-7,7a-dihydro-4H-1-benzofuran-3-one |
|---|---|
| PubChem CID | 11782842 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (3aR,4S,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-4-(methoxymethyl)-6-methyl-7,7a-dihydro-4H-1-benzofuran-3-one |
| SMILES | COC[C@@H]1C=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OCC(=O)[C@]21O |
| InChI | InChI=1S/C17H30O5Si/c1-11-8-12(9-20-5)17(19)13(18)10-21-15(17)14(11)22-23(6,7)16(2,3)4/h8,12,14-15,19H,9-10H2,1-7H3/t12-,14+,15+,17-/m0/s1 |
| InChIKey | UDOCWBCAMURIDA-CRNXPOROSA-N |
| XLogP | 2.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|