C17H34O3Si2 — CID 11782848
[(1Z,3E)-1-methoxy-2-(1-trimethylsilyloxyethenyl)octa-1,3-dienoxy]-trimethylsilane (PubChem CID 11782848) has the molecular formula C17H34O3Si2 and a molecular weight of 342.63 g/mol. Its IUPAC name is [(1Z,3E)-1-methoxy-2-(1-trimethylsilyloxyethenyl)octa-1,3-dienoxy]-trimethylsilane.
| Compound Name | [(1Z,3E)-1-methoxy-2-(1-trimethylsilyloxyethenyl)octa-1,3-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 11782848 |
| Molecular Formula | C17H34O3Si2 |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(1Z,3E)-1-methoxy-2-(1-trimethylsilyloxyethenyl)octa-1,3-dienoxy]-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)C(/C=C/CCCC)=C(/OC)O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O3Si2/c1-10-11-12-13-14-16(15(2)19-21(4,5)6)17(18-3)20-22(7,8)9/h13-14H,2,10-12H2,1,3-9H3/b14-13+,17-16- |
| InChIKey | BCPXKROYFUNCBD-RBPKOWMCSA-N |
| XLogP | 5.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|