About N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide
N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide (PubChem CID 11782933) has the molecular formula C14H20BrNO2S
and a molecular weight of 346.29 g/mol. Its IUPAC name is N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide |
| PubChem CID | 11782933 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N[C@H]1CCC[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrNO2S/c1-10(2)19(17,18)16-14-5-3-4-13(14)11-6-8-12(15)9-7-11/h6-10,13-14,16H,3-5H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | PCKHNNAQTBNCBG-KGLIPLIRSA-N |
| XLogP | 3.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide?
The IUPAC name of N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide (CID 11782933) is N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide.
What is the SMILES notation for N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide?
The canonical SMILES for N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide is CC(C)S(=O)(=O)N[C@H]1CCC[C@@H]1c1ccc(Br)cc1.
What is the InChIKey of N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide?
The InChIKey is PCKHNNAQTBNCBG-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H20BrNO2S/c1-10(2)19(17,18)16-14-5-3-4-13(14)11-6-8-12(15)9-7-11/h6-10,13-14,16H,3-5H2,1-2H3/t13-,14+/m1/s1.
What are the key properties of N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide?
N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide has a molecular weight of 346.29 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2R)-2-(4-bromophenyl)cyclopentyl]propane-2-sulfonamide is sourced from PubChem (CID 11782933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).