About (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one
(3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one (PubChem CID 11782967) has the molecular formula C17H38O3Si2
and a molecular weight of 346.66 g/mol. Its IUPAC name is (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one.
Molecular Properties
| Compound Name | (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one |
| PubChem CID | 11782967 |
| Molecular Formula | C17H38O3Si2 |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one |
| SMILES | CC(=O)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H38O3Si2/c1-14(18)15(20-22(10,11)17(5,6)7)12-13-19-21(8,9)16(2,3)4/h15H,12-13H2,1-11H3/t15-/m0/s1 |
| InChIKey | URTMHUUKKKWXRK-HNNXBMFYSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one?
The IUPAC name of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one (CID 11782967) is (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one.
What is the SMILES notation for (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one?
The canonical SMILES for (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one is CC(=O)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one?
The InChIKey is URTMHUUKKKWXRK-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H38O3Si2/c1-14(18)15(20-22(10,11)17(5,6)7)12-13-19-21(8,9)16(2,3)4/h15H,12-13H2,1-11H3/t15-/m0/s1.
What are the key properties of (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one?
(3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one has a molecular weight of 346.66 g/mol, XLogP of 5.38, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]pentan-2-one is sourced from PubChem (CID 11782967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).