C19H24O6 — CID 11783005
dimethyl (3aS,6S,8aR)-6-acetyloxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate (PubChem CID 11783005) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is dimethyl (3aS,6S,8aR)-6-acetyloxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aS,6S,8aR)-6-acetyloxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11783005 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | dimethyl (3aS,6S,8aR)-6-acetyloxy-3-prop-1-en-2-yl-6,7,8,8a-tetrahydro-3aH-azulene-1,1-dicarboxylate |
| SMILES | C=C(C)C1=CC(C(=O)OC)(C(=O)OC)[C@@H]2CC[C@H](OC(C)=O)C=C[C@H]12 |
| InChI | InChI=1S/C19H24O6/c1-11(2)15-10-19(17(21)23-4,18(22)24-5)16-9-7-13(25-12(3)20)6-8-14(15)16/h6,8,10,13-14,16H,1,7,9H2,2-5H3/t13-,14-,16-/m1/s1 |
| InChIKey | VGZJDQKZACGACS-IIAWOOMASA-N |
| XLogP | 2.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|