C21H34O4 — CID 11783083
(4S)-4-(methoxymethoxy)-4-[(4R,7S)-4,10,11,11-tetramethyl-5-oxo-4-bicyclo[5.3.1]undec-1(10)-enyl]butanal (PubChem CID 11783083) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (4S)-4-(methoxymethoxy)-4-[(4R,7S)-4,10,11,11-tetramethyl-5-oxo-4-bicyclo[5.3.1]undec-1(10)-enyl]butanal.
| Compound Name | (4S)-4-(methoxymethoxy)-4-[(4R,7S)-4,10,11,11-tetramethyl-5-oxo-4-bicyclo[5.3.1]undec-1(10)-enyl]butanal |
|---|---|
| PubChem CID | 11783083 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (4S)-4-(methoxymethoxy)-4-[(4R,7S)-4,10,11,11-tetramethyl-5-oxo-4-bicyclo[5.3.1]undec-1(10)-enyl]butanal |
| SMILES | COCO[C@@H](CCC=O)[C@@]1(C)CCC2=C(C)CC[C@@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C21H34O4/c1-15-8-9-16-13-18(23)21(4,11-10-17(15)20(16,2)3)19(7-6-12-22)25-14-24-5/h12,16,19H,6-11,13-14H2,1-5H3/t16-,19-,21-/m0/s1 |
| InChIKey | PRPOSWVGQAZQQL-LRQRDZAKSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|