C19H26Cl2O2 — CID 11783256
[(1R,2S,5R)-5-methyl-2-[2-(4-methylphenyl)propan-2-yl]cyclohexyl] 2,2-dichloroacetate (PubChem CID 11783256) has the molecular formula C19H26Cl2O2 and a molecular weight of 357.32 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-[2-(4-methylphenyl)propan-2-yl]cyclohexyl] 2,2-dichloroacetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-[2-(4-methylphenyl)propan-2-yl]cyclohexyl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 11783256 |
| Molecular Formula | C19H26Cl2O2 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-[2-(4-methylphenyl)propan-2-yl]cyclohexyl] 2,2-dichloroacetate |
| SMILES | Cc1ccc(C(C)(C)[C@@H]2CC[C@@H](C)C[C@H]2OC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C19H26Cl2O2/c1-12-5-8-14(9-6-12)19(3,4)15-10-7-13(2)11-16(15)23-18(22)17(20)21/h5-6,8-9,13,15-17H,7,10-11H2,1-4H3/t13-,15-,16-/m1/s1 |
| InChIKey | PRHYSRFNGBLZJB-FVQBIDKESA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|