C19H19NO6 — CID 11783258
2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-yl]phenol (PubChem CID 11783258) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-yl]phenol.
| Compound Name | 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 11783258 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-methoxy-5-[4-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-yl]phenol |
| SMILES | COc1ccc(-c2ocnc2-c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C19H19NO6/c1-22-14-6-5-11(7-13(14)21)18-17(20-10-26-18)12-8-15(23-2)19(25-4)16(9-12)24-3/h5-10,21H,1-4H3 |
| InChIKey | IORWTZSITGORCZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |