C15H21BrO5 — CID 11783373
methyl (1S,2R,3S,4S)-5-bromo-8,8-dimethoxy-2,3,6-trimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 11783373) has the molecular formula C15H21BrO5 and a molecular weight of 361.23 g/mol. Its IUPAC name is methyl (1S,2R,3S,4S)-5-bromo-8,8-dimethoxy-2,3,6-trimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2R,3S,4S)-5-bromo-8,8-dimethoxy-2,3,6-trimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11783373 |
| Molecular Formula | C15H21BrO5 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | methyl (1S,2R,3S,4S)-5-bromo-8,8-dimethoxy-2,3,6-trimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[C@@H]2C(=O)C(OC)(OC)[C@@H](C(Br)=C2C)[C@@H]1C |
| InChI | InChI=1S/C15H21BrO5/c1-7-9-12(17)15(20-5,21-6)10(11(7)16)8(2)14(9,3)13(18)19-4/h8-10H,1-6H3/t8-,9-,10+,14+/m0/s1 |
| InChIKey | DLSCXBYFVOEUAW-LFNDISMMSA-N |
| XLogP | 2.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|