C21H19N3O3 — CID 11783380
[8-(4-methylphenyl)-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl] N,N-dimethylcarbamate (PubChem CID 11783380) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is [8-(4-methylphenyl)-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [8-(4-methylphenyl)-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 11783380 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [8-(4-methylphenyl)-9-oxa-2,14-diazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,7,11,13-hexaen-7-yl] N,N-dimethylcarbamate |
| SMILES | Cc1ccc(C2=C(OC(=O)N(C)C)c3cccn3-c3ncccc3O2)cc1 |
| InChI | InChI=1S/C21H19N3O3/c1-14-8-10-15(11-9-14)18-19(27-21(25)23(2)3)16-6-5-13-24(16)20-17(26-18)7-4-12-22-20/h4-13H,1-3H3 |
| InChIKey | FHPZOIWMILGEQL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |