C23H36O4 — CID 11783736
(2E,6E,10E)-11-[(4R,5S)-2,2-dimethyl-5-(2-methylpropanoyl)-1,3-dioxolan-4-yl]-3,7-dimethyldodeca-2,6,10-trienal (PubChem CID 11783736) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (2E,6E,10E)-11-[(4R,5S)-2,2-dimethyl-5-(2-methylpropanoyl)-1,3-dioxolan-4-yl]-3,7-dimethyldodeca-2,6,10-trienal.
| Compound Name | (2E,6E,10E)-11-[(4R,5S)-2,2-dimethyl-5-(2-methylpropanoyl)-1,3-dioxolan-4-yl]-3,7-dimethyldodeca-2,6,10-trienal |
|---|---|
| PubChem CID | 11783736 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (2E,6E,10E)-11-[(4R,5S)-2,2-dimethyl-5-(2-methylpropanoyl)-1,3-dioxolan-4-yl]-3,7-dimethyldodeca-2,6,10-trienal |
| SMILES | C/C(=C\C=O)CC/C=C(\C)CC/C=C(\C)[C@H]1OC(C)(C)O[C@@H]1C(=O)C(C)C |
| InChI | InChI=1S/C23H36O4/c1-16(2)20(25)22-21(26-23(6,7)27-22)19(5)13-9-12-17(3)10-8-11-18(4)14-15-24/h10,13-16,21-22H,8-9,11-12H2,1-7H3/b17-10+,18-14+,19-13+/t21-,22-/m1/s1 |
| InChIKey | MBSSOGJADDEYEC-YIIUAYKISA-N |
| XLogP | 5.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|