C19H38O4Si2 — CID 11784012
[(E)-3-[(3aS,5S,7R,7aS)-5-ethoxy-2,2-dimethyl-3,3a,4,5,7,7a-hexahydrooxasilolo[5,4-c]pyran-7-yl]prop-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11784012) has the molecular formula C19H38O4Si2 and a molecular weight of 386.68 g/mol. Its IUPAC name is [(E)-3-[(3aS,5S,7R,7aS)-5-ethoxy-2,2-dimethyl-3,3a,4,5,7,7a-hexahydrooxasilolo[5,4-c]pyran-7-yl]prop-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E)-3-[(3aS,5S,7R,7aS)-5-ethoxy-2,2-dimethyl-3,3a,4,5,7,7a-hexahydrooxasilolo[5,4-c]pyran-7-yl]prop-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11784012 |
| Molecular Formula | C19H38O4Si2 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | [(E)-3-[(3aS,5S,7R,7aS)-5-ethoxy-2,2-dimethyl-3,3a,4,5,7,7a-hexahydrooxasilolo[5,4-c]pyran-7-yl]prop-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CCO[C@@H]1C[C@@H]2C[Si](C)(C)O[C@@H]2[C@@H](/C=C/CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H38O4Si2/c1-9-20-17-13-15-14-24(5,6)23-18(15)16(22-17)11-10-12-21-25(7,8)19(2,3)4/h10-11,15-18H,9,12-14H2,1-8H3/b11-10+/t15-,16-,17+,18+/m1/s1 |
| InChIKey | TUJRGVKPYRKIHF-HIYOHROESA-N |
| XLogP | 4.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|