C21H28O5Si — CID 11784059
(3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2,3,4-triol (PubChem CID 11784059) has the molecular formula C21H28O5Si and a molecular weight of 388.54 g/mol. Its IUPAC name is (3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2,3,4-triol.
| Compound Name | (3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 11784059 |
| Molecular Formula | C21H28O5Si |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (3R,4R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolane-2,3,4-triol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1OC(O)[C@H](O)[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O5Si/c1-21(2,3)27(15-10-6-4-7-11-15,16-12-8-5-9-13-16)25-14-17-18(22)19(23)20(24)26-17/h4-13,17-20,22-24H,14H2,1-3H3/t17-,18-,19+,20?/m0/s1 |
| InChIKey | UBTTVAWQIDVDNL-GURQWTFNSA-N |
| XLogP | 1.00 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|