C21H33NO4Si — CID 11784145
benzyl (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate (PubChem CID 11784145) has the molecular formula C21H33NO4Si and a molecular weight of 391.58 g/mol. Its IUPAC name is benzyl (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate.
| Compound Name | benzyl (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate |
|---|---|
| PubChem CID | 11784145 |
| Molecular Formula | C21H33NO4Si |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | benzyl (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1[C@@H](C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H33NO4Si/c1-14(20(24)25-13-16-11-9-8-10-12-16)18-17(19(23)22-18)15(2)26-27(6,7)21(3,4)5/h8-12,14-15,17-18H,13H2,1-7H3,(H,22,23)/t14-,15-,17-,18-/m1/s1 |
| InChIKey | IALHZITVANRGAL-JOCBIADPSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|