About 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole
3,5-bis(3-bromophenyl)-1,2,4-thiadiazole (PubChem CID 11784241) has the molecular formula C14H8Br2N2S
and a molecular weight of 396.11 g/mol. Its IUPAC name is 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole |
| PubChem CID | 11784241 |
| Molecular Formula | C14H8Br2N2S |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole |
| SMILES | Brc1cccc(-c2nsc(-c3cccc(Br)c3)n2)c1 |
| InChI | InChI=1S/C14H8Br2N2S/c15-11-5-1-3-9(7-11)13-17-14(19-18-13)10-4-2-6-12(16)8-10/h1-8H |
| InChIKey | YBTWNEJNSBOKLJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.11 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole?
The IUPAC name of 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole (CID 11784241) is 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole.
What is the SMILES notation for 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole?
The canonical SMILES for 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole is Brc1cccc(-c2nsc(-c3cccc(Br)c3)n2)c1.
What is the InChIKey of 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole?
The InChIKey is YBTWNEJNSBOKLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Br2N2S/c15-11-5-1-3-9(7-11)13-17-14(19-18-13)10-4-2-6-12(16)8-10/h1-8H.
What are the key properties of 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole?
3,5-bis(3-bromophenyl)-1,2,4-thiadiazole has a molecular weight of 396.11 g/mol, XLogP of 5.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(3-bromophenyl)-1,2,4-thiadiazole is sourced from PubChem (CID 11784241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).