C21H23N3O5 — CID 11784273
tert-butyl 4-[(2R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate (PubChem CID 11784273) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is tert-butyl 4-[(2R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate |
|---|---|
| PubChem CID | 11784273 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | tert-butyl 4-[(2R,5R)-5-[(1,3-dioxoisoindol-2-yl)methyl]oxolan-2-yl]imidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cnc([C@H]2CC[C@H](CN3C(=O)c4ccccc4C3=O)O2)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-21(2,3)29-20(27)23-11-16(22-12-23)17-9-8-13(28-17)10-24-18(25)14-6-4-5-7-15(14)19(24)26/h4-7,11-13,17H,8-10H2,1-3H3/t13-,17-/m1/s1 |
| InChIKey | NNXGTGZEMXOQIY-CXAGYDPISA-N |
| XLogP | 3.18 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|