C19H36O5Si2 — CID 11784356
(3aR,4S,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-6-methyl-3a-trimethylsilyloxy-7,7a-dihydro-4H-1-benzofuran-3-one (PubChem CID 11784356) has the molecular formula C19H36O5Si2 and a molecular weight of 400.66 g/mol. Its IUPAC name is (3aR,4S,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-6-methyl-3a-trimethylsilyloxy-7,7a-dihydro-4H-1-benzofuran-3-one.
| Compound Name | (3aR,4S,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-6-methyl-3a-trimethylsilyloxy-7,7a-dihydro-4H-1-benzofuran-3-one |
|---|---|
| PubChem CID | 11784356 |
| Molecular Formula | C19H36O5Si2 |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (3aR,4S,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-hydroxy-6-methyl-3a-trimethylsilyloxy-7,7a-dihydro-4H-1-benzofuran-3-one |
| SMILES | CC1=C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@]2(O[Si](C)(C)C)C(=O)CO[C@@H]2[C@H]1O |
| InChI | InChI=1S/C19H36O5Si2/c1-13-10-14(11-23-26(8,9)18(2,3)4)19(24-25(5,6)7)15(20)12-22-17(19)16(13)21/h10,14,16-17,21H,11-12H2,1-9H3/t14-,16-,17+,19-/m0/s1 |
| InChIKey | LOPQJGUCUATCQB-RMRDIRSESA-N |
| XLogP | 3.50 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|