C18H28O8S — CID 11784456
1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 4-methylbenzenesulfonate (PubChem CID 11784456) has the molecular formula C18H28O8S and a molecular weight of 404.48 g/mol. Its IUPAC name is 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 4-methylbenzenesulfonate.
| Compound Name | 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11784456 |
| Molecular Formula | C18H28O8S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2COCCOCCOCCOCCO2)cc1 |
| InChI | InChI=1S/C18H28O8S/c1-16-2-4-18(5-3-16)27(19,20)26-15-17-14-24-11-10-22-7-6-21-8-9-23-12-13-25-17/h2-5,17H,6-15H2,1H3 |
| InChIKey | SKNTZKKWMSXDSU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|