C20H11BrN4O3S — CID 11784593
8-amino-17-bromo-3-phenyl-4-sulfanylidene-7,11-dioxa-3,5,13-triazapentacyclo[10.7.0.01,9.02,6.014,19]nonadeca-2(6),8,12,14(19),15,17-hexaen-10-one (PubChem CID 11784593) has the molecular formula C20H11BrN4O3S and a molecular weight of 467.30 g/mol. Its IUPAC name is 8-amino-17-bromo-3-phenyl-4-sulfanylidene-7,11-dioxa-3,5,13-triazapentacyclo[10.7.0.01,9.02,6.014,19]nonadeca-2(6),8,12,14(19),15,17-hexaen-10-one.
| Compound Name | 8-amino-17-bromo-3-phenyl-4-sulfanylidene-7,11-dioxa-3,5,13-triazapentacyclo[10.7.0.01,9.02,6.014,19]nonadeca-2(6),8,12,14(19),15,17-hexaen-10-one |
|---|---|
| PubChem CID | 11784593 |
| Molecular Formula | C20H11BrN4O3S |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 8-amino-17-bromo-3-phenyl-4-sulfanylidene-7,11-dioxa-3,5,13-triazapentacyclo[10.7.0.01,9.02,6.014,19]nonadeca-2(6),8,12,14(19),15,17-hexaen-10-one |
| SMILES | NC1=C2C(=O)OC3=Nc4ccc(Br)cc4C32c2c([nH]c(=S)n2-c2ccccc2)O1 |
| InChI | InChI=1S/C20H11BrN4O3S/c21-9-6-7-12-11(8-9)20-13(17(26)28-18(20)23-12)15(22)27-16-14(20)25(19(29)24-16)10-4-2-1-3-5-10/h1-8H,22H2,(H,24,29) |
| InChIKey | BPYBJSYORBRWIN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|