C26H33NO5Si — CID 11784610
tert-butyl (1S,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 11784610) has the molecular formula C26H33NO5Si and a molecular weight of 467.64 g/mol. Its IUPAC name is tert-butyl (1S,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | tert-butyl (1S,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 11784610 |
| Molecular Formula | C26H33NO5Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | tert-butyl (1S,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)OC(=O)[C@@H]21 |
| InChI | InChI=1S/C26H33NO5Si/c1-25(2,3)32-24(29)27-21-20(31-23(28)22(21)27)17-30-33(26(4,5)6,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16,20-22H,17H2,1-6H3/t20-,21-,22-,27?/m1/s1 |
| InChIKey | HDVDDMFUTAOZPM-LPOKKUQKSA-N |
| XLogP | 3.48 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|