C29H28N2O4 — CID 11784635
1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate (PubChem CID 11784635) has the molecular formula C29H28N2O4 and a molecular weight of 468.55 g/mol. Its IUPAC name is 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate.
| Compound Name | 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate |
|---|---|
| PubChem CID | 11784635 |
| Molecular Formula | C29H28N2O4 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 1-O-benzyl 8-O-methyl (3aS,4S,9bS)-4-[(E)-2-phenylethenyl]-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1,8-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@@H]1[C@@H](CCN1C(=O)OCc1ccccc1)[C@H](/C=C/c1ccccc1)N2 |
| InChI | InChI=1S/C29H28N2O4/c1-34-28(32)22-13-15-26-24(18-22)27-23(25(30-26)14-12-20-8-4-2-5-9-20)16-17-31(27)29(33)35-19-21-10-6-3-7-11-21/h2-15,18,23,25,27,30H,16-17,19H2,1H3/b14-12+/t23-,25-,27-/m0/s1 |
| InChIKey | LFKUDNAUOMBNEK-KRMFFUQWSA-N |
| XLogP | 5.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |