C27H20N4O5 — CID 11784911
2-[7-(furan-2-carbonyl)-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-3-yl]acetic acid (PubChem CID 11784911) has the molecular formula C27H20N4O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-[7-(furan-2-carbonyl)-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-3-yl]acetic acid.
| Compound Name | 2-[7-(furan-2-carbonyl)-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-3-yl]acetic acid |
|---|---|
| PubChem CID | 11784911 |
| Molecular Formula | C27H20N4O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 2-[7-(furan-2-carbonyl)-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-3-yl]acetic acid |
| SMILES | Cn1cc2c(n1)CCc1c-2c2c(c3c4cc(C(=O)c5ccco5)ccc4n(CC(=O)O)c13)CNC2=O |
| InChI | InChI=1S/C27H20N4O5/c1-30-11-17-18(29-30)6-5-14-22(17)24-16(10-28-27(24)35)23-15-9-13(26(34)20-3-2-8-36-20)4-7-19(15)31(25(14)23)12-21(32)33/h2-4,7-9,11H,5-6,10,12H2,1H3,(H,28,35)(H,32,33) |
| InChIKey | JQKFYQAARWHATP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|