C26H54O4Si2 — CID 11785052
(2R,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dien-1-ol (PubChem CID 11785052) has the molecular formula C26H54O4Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is (2R,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dien-1-ol.
| Compound Name | (2R,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dien-1-ol |
|---|---|
| PubChem CID | 11785052 |
| Molecular Formula | C26H54O4Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | (2R,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dien-1-ol |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(/C)[C@H](O[Si](CC)(CC)CC)[C@H](C)CO |
| InChI | InChI=1S/C26H54O4Si2/c1-14-23(28-11)25(29-31(12,13)26(8,9)10)21(6)18-20(5)24(22(7)19-27)30-32(15-2,16-3)17-4/h14,18,21-25,27H,1,15-17,19H2,2-13H3/b20-18-/t21-,22-,23+,24+,25+/m1/s1 |
| InChIKey | UUNLOKYUQFLOHR-GLTZYJCRSA-N |
| XLogP | 7.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|