C28H16N2O7 — CID 11785175
2-(4-hydroxyphenyl)-5-[2-(4-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione (PubChem CID 11785175) has the molecular formula C28H16N2O7 and a molecular weight of 492.44 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-5-[2-(4-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione.
| Compound Name | 2-(4-hydroxyphenyl)-5-[2-(4-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11785175 |
| Molecular Formula | C28H16N2O7 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-(4-hydroxyphenyl)-5-[2-(4-hydroxyphenyl)-1,3-dioxoisoindol-5-yl]oxyisoindole-1,3-dione |
| SMILES | O=C1c2ccc(Oc3ccc4c(c3)C(=O)N(c3ccc(O)cc3)C4=O)cc2C(=O)N1c1ccc(O)cc1 |
| InChI | InChI=1S/C28H16N2O7/c31-17-5-1-15(2-6-17)29-25(33)21-11-9-19(13-23(21)27(29)35)37-20-10-12-22-24(14-20)28(36)30(26(22)34)16-3-7-18(32)8-4-16/h1-14,31-32H |
| InChIKey | UAELTPGLYWDJFC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|