C30H36O6 — CID 11785187
(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(2-phenylethyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 11785187) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is (1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(2-phenylethyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(2-phenylethyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 11785187 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-6-(2-phenylethyl)-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@H]1OC(CCc3ccccc3)O[C@]12C(=O)CO |
| InChI | InChI=1S/C30H36O6/c1-28-13-12-20(32)14-19(28)9-10-21-22-15-25-30(24(34)17-31,29(22,2)16-23(33)27(21)28)36-26(35-25)11-8-18-6-4-3-5-7-18/h3-7,12-14,21-23,25-27,31,33H,8-11,15-17H2,1-2H3/t21-,22-,23-,25+,26?,27+,28-,29-,30+/m0/s1 |
| InChIKey | GKXHJZLYENOENS-HHIQYLRFSA-N |
| XLogP | 3.55 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |