C29H29N3O5 — CID 11785312
diethyl 2-morpholin-4-yl-4,7-diphenylpyrrolo[1,2-b]pyridazine-5,6-dicarboxylate (PubChem CID 11785312) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is diethyl 2-morpholin-4-yl-4,7-diphenylpyrrolo[1,2-b]pyridazine-5,6-dicarboxylate.
| Compound Name | diethyl 2-morpholin-4-yl-4,7-diphenylpyrrolo[1,2-b]pyridazine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 11785312 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | diethyl 2-morpholin-4-yl-4,7-diphenylpyrrolo[1,2-b]pyridazine-5,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c2c(-c3ccccc3)cc(N3CCOCC3)nn2c1-c1ccccc1 |
| InChI | InChI=1S/C29H29N3O5/c1-3-36-28(33)24-25(29(34)37-4-2)27-22(20-11-7-5-8-12-20)19-23(31-15-17-35-18-16-31)30-32(27)26(24)21-13-9-6-10-14-21/h5-14,19H,3-4,15-18H2,1-2H3 |
| InChIKey | KYOXLEZIYMUPQI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |