C22H24N6O4S2 — CID 11785326
3-[[4-[(4-acetylpiperazin-1-yl)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide (PubChem CID 11785326) has the molecular formula C22H24N6O4S2 and a molecular weight of 500.61 g/mol. Its IUPAC name is 3-[[4-[(4-acetylpiperazin-1-yl)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[4-[(4-acetylpiperazin-1-yl)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 11785326 |
| Molecular Formula | C22H24N6O4S2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 3-[[4-[(4-acetylpiperazin-1-yl)methyl]-8-oxa-5-thia-11,13-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),3,9,11-pentaen-12-yl]amino]benzenesulfonamide |
| SMILES | CC(=O)N1CCN(Cc2cc3c(s2)COc2cnc(Nc4cccc(S(N)(=O)=O)c4)nc2-3)CC1 |
| InChI | InChI=1S/C22H24N6O4S2/c1-14(29)28-7-5-27(6-8-28)12-16-10-18-20(33-16)13-32-19-11-24-22(26-21(18)19)25-15-3-2-4-17(9-15)34(23,30)31/h2-4,9-11H,5-8,12-13H2,1H3,(H2,23,30,31)(H,24,25,26) |
| InChIKey | SIZCRYVKZMQYSL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |