C14H18Cl3NO2S — CID 1178561
2,4,5-trichloro-N-cyclohexyl-N-ethylbenzenesulfonamide (PubChem CID 1178561) has the molecular formula C14H18Cl3NO2S and a molecular weight of 370.73 g/mol. Its IUPAC name is 2,4,5-trichloro-N-cyclohexyl-N-ethylbenzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-cyclohexyl-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1178561 |
| Molecular Formula | C14H18Cl3NO2S |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2,4,5-trichloro-N-cyclohexyl-N-ethylbenzenesulfonamide |
| SMILES | CCN(C1CCCCC1)S(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl3NO2S/c1-2-18(10-6-4-3-5-7-10)21(19,20)14-9-12(16)11(15)8-13(14)17/h8-10H,2-7H2,1H3 |
| InChIKey | LZULHUZNUMZEQC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|