C24H47ClOSiSn — CID 11785928
[(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-trimethylsilane (PubChem CID 11785928) has the molecular formula C24H47ClOSiSn and a molecular weight of 533.89 g/mol. Its IUPAC name is [(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-trimethylsilane.
| Compound Name | [(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11785928 |
| Molecular Formula | C24H47ClOSiSn |
| Molecular Weight | 533.89 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | [(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-trimethylsilane |
| SMILES | C=C(Cl)/C=C/[C@H](CC(=C)C[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H20ClOSi.3C4H9.Sn/c1-10(2)9-12(8-7-11(3)13)14-15(4,5)6;3*1-3-4-2;/h7-8,12H,1-3,9H2,4-6H3;3*1,3-4H2,2H3;/b8-7+;;;;/t12-;;;;/m1..../s1 |
| InChIKey | IFTTXLXZDXPPKS-JSWVOBLSSA-N |
| XLogP | 9.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.89 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|