C29H58O6Si2 — CID 11786271
[(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (2S,3S)-2,3,6-trimethylhept-5-enoate (PubChem CID 11786271) has the molecular formula C29H58O6Si2 and a molecular weight of 558.95 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (2S,3S)-2,3,6-trimethylhept-5-enoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (2S,3S)-2,3,6-trimethylhept-5-enoate |
|---|---|
| PubChem CID | 11786271 |
| Molecular Formula | C29H58O6Si2 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2-methyloxan-3-yl] (2S,3S)-2,3,6-trimethylhept-5-enoate |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](OC(=O)[C@@H](C)[C@@H](C)CC=C(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H58O6Si2/c1-19(2)17-18-20(3)21(4)26(30)33-23-22(5)32-27(31-12)25(35-37(15,16)29(9,10)11)24(23)34-36(13,14)28(6,7)8/h17,20-25,27H,18H2,1-16H3/t20-,21-,22+,23+,24-,25+,27-/m0/s1 |
| InChIKey | FZWVBWVXTUTZMZ-ZIDNHULNSA-N |
| XLogP | 7.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|