About N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide
N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide (PubChem CID 11786460) has the molecular formula C34H40N2O2S2
and a molecular weight of 572.84 g/mol. Its IUPAC name is N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide.
Molecular Properties
| Compound Name | N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide |
| PubChem CID | 11786460 |
| Molecular Formula | C34H40N2O2S2 |
| Molecular Weight | 572.84 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide |
| SMILES | O=C(c1ccccc1S)N(N(C(=O)c1ccccc1S)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C34H40N2O2S2/c37-31(27-5-1-3-7-29(27)39)35(33-15-21-9-22(16-33)11-23(10-21)17-33)36(32(38)28-6-2-4-8-30(28)40)34-18-24-12-25(19-34)14-26(13-24)20-34/h1-8,21-26,39-40H,9-20H2 |
| InChIKey | QSXOXOFJOZOUNE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.84 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide?
The IUPAC name of N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide (CID 11786460) is N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide.
What is the SMILES notation for N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide?
The canonical SMILES for N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide is O=C(c1ccccc1S)N(N(C(=O)c1ccccc1S)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide?
The InChIKey is QSXOXOFJOZOUNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H40N2O2S2/c37-31(27-5-1-3-7-29(27)39)35(33-15-21-9-22(16-33)11-23(10-21)17-33)36(32(38)28-6-2-4-8-30(28)40)34-18-24-12-25(19-34)14-26(13-24)20-34/h1-8,21-26,39-40H,9-20H2.
What are the key properties of N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide?
N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide has a molecular weight of 572.84 g/mol, XLogP of 7.70, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(1-adamantyl)-2-sulfanyl-N'-(2-sulfanylbenzoyl)benzohydrazide is sourced from PubChem (CID 11786460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).