C31H42F3NO4Si — CID 11786523
tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-2-[(2,2,2-trifluoroacetyl)amino]oct-4-enoate (PubChem CID 11786523) has the molecular formula C31H42F3NO4Si and a molecular weight of 577.76 g/mol. Its IUPAC name is tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-2-[(2,2,2-trifluoroacetyl)amino]oct-4-enoate.
| Compound Name | tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-2-[(2,2,2-trifluoroacetyl)amino]oct-4-enoate |
|---|---|
| PubChem CID | 11786523 |
| Molecular Formula | C31H42F3NO4Si |
| Molecular Weight | 577.76 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | tert-butyl (E,2S,6S)-6-[tert-butyl(diphenyl)silyl]oxy-7-methyl-2-[(2,2,2-trifluoroacetyl)amino]oct-4-enoate |
| SMILES | CC(C)[C@@H](/C=C/C[C@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H42F3NO4Si/c1-22(2)26(21-15-20-25(27(36)38-29(3,4)5)35-28(37)31(32,33)34)39-40(30(6,7)8,23-16-11-9-12-17-23)24-18-13-10-14-19-24/h9-19,21-22,25-26H,20H2,1-8H3,(H,35,37)/b21-15+/t25-,26+/m0/s1 |
| InChIKey | OXWSRAIOPWMMNI-GJWGBHSTSA-N |
| XLogP | 5.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.76 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|