C34H70O4Si2 — CID 11786726
[(2R,3S,5R,7S,9S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltridec-12-enyl] 2,2-dimethylpropanoate (PubChem CID 11786726) has the molecular formula C34H70O4Si2 and a molecular weight of 599.10 g/mol. Its IUPAC name is [(2R,3S,5R,7S,9S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltridec-12-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,5R,7S,9S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltridec-12-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11786726 |
| Molecular Formula | C34H70O4Si2 |
| Molecular Weight | 599.10 g/mol |
| Exact Mass | 598.48 |
| IUPAC Name | [(2R,3S,5R,7S,9S,10S)-2,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5,7,9-tetramethyltridec-12-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@H](C)[C@H](COC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H70O4Si2/c1-19-20-29(37-39(15,16)33(9,10)11)27(4)22-25(2)21-26(3)23-28(5)30(24-36-31(35)32(6,7)8)38-40(17,18)34(12,13)14/h19,25-30H,1,20-24H2,2-18H3/t25-,26+,27-,28-,29-,30-/m0/s1 |
| InChIKey | VQSYEDIBTSZZBE-CEIPDFQMSA-N |
| XLogP | 10.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.10 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|