C38H48F2N2O2 — CID 11786769
N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-ditert-butylbenzamide (PubChem CID 11786769) has the molecular formula C38H48F2N2O2 and a molecular weight of 602.81 g/mol. Its IUPAC name is N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-ditert-butylbenzamide.
| Compound Name | N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-ditert-butylbenzamide |
|---|---|
| PubChem CID | 11786769 |
| Molecular Formula | C38H48F2N2O2 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.37 |
| IUPAC Name | N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-ditert-butylbenzamide |
| SMILES | CC(C)(C)c1cc(C(=O)NCC2CCN(C(=O)CCCCC(c3ccc(F)cc3)c3ccc(F)cc3)C2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H48F2N2O2/c1-37(2,3)30-21-29(22-31(23-30)38(4,5)6)36(44)41-24-26-19-20-42(25-26)35(43)10-8-7-9-34(27-11-15-32(39)16-12-27)28-13-17-33(40)18-14-28/h11-18,21-23,26,34H,7-10,19-20,24-25H2,1-6H3,(H,41,44) |
| InChIKey | LCVAXBGAPPQTSM-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|